C21H17N3OS — CID 7708389
2-(1,3-benzothiazol-2-yl)-N-benzyl-N-methylpyridine-3-carboxamide (PubChem CID 7708389) has the molecular formula C21H17N3OS and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N-benzyl-N-methylpyridine-3-carboxamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N-benzyl-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 7708389 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N-benzyl-N-methylpyridine-3-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cccnc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H17N3OS/c1-24(14-15-8-3-2-4-9-15)21(25)16-10-7-13-22-19(16)20-23-17-11-5-6-12-18(17)26-20/h2-13H,14H2,1H3 |
| InChIKey | MSWPSIYIMQSAKQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |