C25H18N4OS — CID 18858913
2-(1,3-benzothiazol-2-yl)-N',N'-diphenylpyridine-3-carbohydrazide (PubChem CID 18858913) has the molecular formula C25H18N4OS and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N',N'-diphenylpyridine-3-carbohydrazide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N',N'-diphenylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 18858913 |
| Molecular Formula | C25H18N4OS |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N',N'-diphenylpyridine-3-carbohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccccc1)c1cccnc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H18N4OS/c30-24(28-29(18-10-3-1-4-11-18)19-12-5-2-6-13-19)20-14-9-17-26-23(20)25-27-21-15-7-8-16-22(21)31-25/h1-17H,(H,28,30) |
| InChIKey | OFDNVHQIXDLPOT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|