C16H9N5O3S2 — CID 18858870
2-(1,3-benzothiazol-2-yl)-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-carboxamide (PubChem CID 18858870) has the molecular formula C16H9N5O3S2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18858870 |
| Molecular Formula | C16H9N5O3S2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-N-(5-nitro-1,3-thiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1cccnc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H9N5O3S2/c22-14(20-16-18-8-12(26-16)21(23)24)9-4-3-7-17-13(9)15-19-10-5-1-2-6-11(10)25-15/h1-8H,(H,18,20,22) |
| InChIKey | ILKKTGWJPALNQG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|