C19H14Cl2FNO — CID 18288270
2,4-dichloro-5-fluoro-N-methyl-N-(naphthalen-2-ylmethyl)benzamide (PubChem CID 18288270) has the molecular formula C19H14Cl2FNO and a molecular weight of 362.23 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-methyl-N-(naphthalen-2-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-methyl-N-(naphthalen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18288270 |
| Molecular Formula | C19H14Cl2FNO |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-methyl-N-(naphthalen-2-ylmethyl)benzamide |
| SMILES | CN(Cc1ccc2ccccc2c1)C(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl2FNO/c1-23(19(24)15-9-18(22)17(21)10-16(15)20)11-12-6-7-13-4-2-3-5-14(13)8-12/h2-10H,11H2,1H3 |
| InChIKey | FDIKRCJTVAETLL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|