C17H14Cl2FNO3 — CID 37415657
methyl 4-[[(2,4-dichloro-5-fluorobenzoyl)-methylamino]methyl]benzoate (PubChem CID 37415657) has the molecular formula C17H14Cl2FNO3 and a molecular weight of 370.21 g/mol. Its IUPAC name is methyl 4-[[(2,4-dichloro-5-fluorobenzoyl)-methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[(2,4-dichloro-5-fluorobenzoyl)-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 37415657 |
| Molecular Formula | C17H14Cl2FNO3 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | methyl 4-[[(2,4-dichloro-5-fluorobenzoyl)-methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)C(=O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2FNO3/c1-21(9-10-3-5-11(6-4-10)17(23)24-2)16(22)12-7-15(20)14(19)8-13(12)18/h3-8H,9H2,1-2H3 |
| InChIKey | KGOOKITZIQMJNO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|