C16H12ClF2NO3 — CID 4810749
methyl 4-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]benzoate (PubChem CID 4810749) has the molecular formula C16H12ClF2NO3 and a molecular weight of 339.73 g/mol. Its IUPAC name is methyl 4-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 4810749 |
| Molecular Formula | C16H12ClF2NO3 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl 4-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H12ClF2NO3/c1-23-16(22)10-4-2-9(3-5-10)8-20-15(21)11-6-13(18)14(19)7-12(11)17/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | KZWWXJMMHZIQKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|