C16H12ClF2NO4 — CID 45384785
5-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid (PubChem CID 45384785) has the molecular formula C16H12ClF2NO4 and a molecular weight of 355.72 g/mol. Its IUPAC name is 5-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 45384785 |
| Molecular Formula | C16H12ClF2NO4 |
| Molecular Weight | 355.72 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-[[(2-chloro-4,5-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(CNC(=O)c2cc(F)c(F)cc2Cl)cc1C(=O)O |
| InChI | InChI=1S/C16H12ClF2NO4/c1-24-14-3-2-8(4-10(14)16(22)23)7-20-15(21)9-5-12(18)13(19)6-11(9)17/h2-6H,7H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | JKGGXJOTJBLGBV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|