C17H14FN3O4 — CID 138041845
5-[[(6-fluoro-1H-benzimidazole-4-carbonyl)amino]methyl]-2-methoxybenzoic acid (PubChem CID 138041845) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is 5-[[(6-fluoro-1H-benzimidazole-4-carbonyl)amino]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[(6-fluoro-1H-benzimidazole-4-carbonyl)amino]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 138041845 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-[[(6-fluoro-1H-benzimidazole-4-carbonyl)amino]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(CNC(=O)c2cc(F)cc3[nH]cnc23)cc1C(=O)O |
| InChI | InChI=1S/C17H14FN3O4/c1-25-14-3-2-9(4-11(14)17(23)24)7-19-16(22)12-5-10(18)6-13-15(12)21-8-20-13/h2-6,8H,7H2,1H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | FEUSKEWDTVFKLJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |