C16H13F2NO4 — CID 45384671
5-[[(2,6-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid (PubChem CID 45384671) has the molecular formula C16H13F2NO4 and a molecular weight of 321.28 g/mol. Its IUPAC name is 5-[[(2,6-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[(2,6-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 45384671 |
| Molecular Formula | C16H13F2NO4 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[[(2,6-difluorobenzoyl)amino]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(CNC(=O)c2c(F)cccc2F)cc1C(=O)O |
| InChI | InChI=1S/C16H13F2NO4/c1-23-13-6-5-9(7-10(13)16(21)22)8-19-15(20)14-11(17)3-2-4-12(14)18/h2-7H,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | OHMYXJWWGULYEZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |