methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate

C17H15Cl2NO3 — CID 37417321

IUPACmethyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate
SMILESCOC(=O)c1ccc(CN(C)C(=O)c2cccc(Cl)c2Cl)cc1
InChIInChI=1S/C17H15Cl2NO3/c1-20(16(21)13-4-3-5-14(18)15(13)19)10-11-6-8-12(9-7-11)17(22)23-2/h3-9H,10H2,1-2H3
InChIKeyWWNOPXQFAKJKMF-UHFFFAOYSA-N
MW352.22 g/mol
LogP4.05
Rot. Bonds4

About methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate

methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate (PubChem CID 37417321) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate
PubChem CID37417321
Molecular FormulaC17H15Cl2NO3
Molecular Weight352.22 g/mol
Exact Mass351.04
IUPAC Namemethyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate
SMILESCOC(=O)c1ccc(CN(C)C(=O)c2cccc(Cl)c2Cl)cc1
InChIInChI=1S/C17H15Cl2NO3/c1-20(16(21)13-4-3-5-14(18)15(13)19)10-11-6-8-12(9-7-11)17(22)23-2/h3-9H,10H2,1-2H3
InChIKeyWWNOPXQFAKJKMF-UHFFFAOYSA-N
XLogP4.05
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.22
LogP ≤ 54.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate?
The IUPAC name of methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate (CID 37417321) is methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate.
What is the SMILES notation for methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate?
The canonical SMILES for methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate is COC(=O)c1ccc(CN(C)C(=O)c2cccc(Cl)c2Cl)cc1.
What is the InChIKey of methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate?
The InChIKey is WWNOPXQFAKJKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2NO3/c1-20(16(21)13-4-3-5-14(18)15(13)19)10-11-6-8-12(9-7-11)17(22)23-2/h3-9H,10H2,1-2H3.
What are the key properties of methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate?
methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate has a molecular weight of 352.22 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(2,3-dichlorobenzoyl)-methylamino]methyl]benzoate is sourced from PubChem (CID 37417321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).