C12H13Cl2N3OS — CID 88807847
3-(cyanomethylsulfanyl)-1-(3,4-dichlorophenyl)-1-propylurea (PubChem CID 88807847) has the molecular formula C12H13Cl2N3OS and a molecular weight of 318.23 g/mol. Its IUPAC name is 3-(cyanomethylsulfanyl)-1-(3,4-dichlorophenyl)-1-propylurea.
| Compound Name | 3-(cyanomethylsulfanyl)-1-(3,4-dichlorophenyl)-1-propylurea |
|---|---|
| PubChem CID | 88807847 |
| Molecular Formula | C12H13Cl2N3OS |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 3-(cyanomethylsulfanyl)-1-(3,4-dichlorophenyl)-1-propylurea |
| SMILES | CCCN(C(=O)NSCC#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N3OS/c1-2-6-17(12(18)16-19-7-5-15)9-3-4-10(13)11(14)8-9/h3-4,8H,2,6-7H2,1H3,(H,16,18) |
| InChIKey | OFLSRNAFLPGPSD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|