C21H15Cl3N2OS — CID 46256118
4-chloro-N-(3,4-dichlorophenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256118) has the molecular formula C21H15Cl3N2OS and a molecular weight of 449.79 g/mol. Its IUPAC name is 4-chloro-N-(3,4-dichlorophenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(3,4-dichlorophenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46256118 |
| Molecular Formula | C21H15Cl3N2OS |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | 4-chloro-N-(3,4-dichlorophenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CCCN(C(=O)c1cc2c(Cl)nc3ccccc3c2s1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl3N2OS/c1-2-9-26(12-7-8-15(22)16(23)10-12)21(27)18-11-14-19(28-18)13-5-3-4-6-17(13)25-20(14)24/h3-8,10-11H,2,9H2,1H3 |
| InChIKey | MFMITPBDSALIKG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|