C13H15Cl2NO2 — CID 82317639
3-(3,4-dichloro-N-prop-2-enylanilino)-2-methylpropanoic acid (PubChem CID 82317639) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is 3-(3,4-dichloro-N-prop-2-enylanilino)-2-methylpropanoic acid.
| Compound Name | 3-(3,4-dichloro-N-prop-2-enylanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82317639 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(3,4-dichloro-N-prop-2-enylanilino)-2-methylpropanoic acid |
| SMILES | C=CCN(CC(C)C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO2/c1-3-6-16(8-9(2)13(17)18)10-4-5-11(14)12(15)7-10/h3-5,7,9H,1,6,8H2,2H3,(H,17,18) |
| InChIKey | XSCGPQPRYGSXEH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|