C13H14F3NO2 — CID 82317722
2-methyl-3-(2,3,4-trifluoro-N-prop-2-enylanilino)propanoic acid (PubChem CID 82317722) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-methyl-3-(2,3,4-trifluoro-N-prop-2-enylanilino)propanoic acid.
| Compound Name | 2-methyl-3-(2,3,4-trifluoro-N-prop-2-enylanilino)propanoic acid |
|---|---|
| PubChem CID | 82317722 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-methyl-3-(2,3,4-trifluoro-N-prop-2-enylanilino)propanoic acid |
| SMILES | C=CCN(CC(C)C(=O)O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H14F3NO2/c1-3-6-17(7-8(2)13(18)19)10-5-4-9(14)11(15)12(10)16/h3-5,8H,1,6-7H2,2H3,(H,18,19) |
| InChIKey | CZYGSLKIULSXOK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|