C12H11F3N2O2 — CID 82318555
3-[N-(cyanomethyl)-2,3,4-trifluoroanilino]-2-methylpropanoic acid (PubChem CID 82318555) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 3-[N-(cyanomethyl)-2,3,4-trifluoroanilino]-2-methylpropanoic acid.
| Compound Name | 3-[N-(cyanomethyl)-2,3,4-trifluoroanilino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82318555 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-[N-(cyanomethyl)-2,3,4-trifluoroanilino]-2-methylpropanoic acid |
| SMILES | CC(CN(CC#N)c1ccc(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H11F3N2O2/c1-7(12(18)19)6-17(5-4-16)9-3-2-8(13)10(14)11(9)15/h2-3,7H,5-6H2,1H3,(H,18,19) |
| InChIKey | ZYJHZKILXYUSMI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|