2-(2,3,4-trifluoro-N-methylanilino)propanoic acid

C10H10F3NO2 — CID 67367878

IUPAC2-(2,3,4-trifluoro-N-methylanilino)propanoic acid
SMILESCC(C(=O)O)N(C)c1ccc(F)c(F)c1F
InChIInChI=1S/C10H10F3NO2/c1-5(10(15)16)14(2)7-4-3-6(11)8(12)9(7)13/h3-5H,1-2H3,(H,15,16)
InChIKeyXMAWWCQAZMERRF-UHFFFAOYSA-N
MW233.19 g/mol
LogP2.01
Rot. Bonds3

About 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid

2-(2,3,4-trifluoro-N-methylanilino)propanoic acid (PubChem CID 67367878) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid.

Molecular Properties

Compound Name2-(2,3,4-trifluoro-N-methylanilino)propanoic acid
PubChem CID67367878
Molecular FormulaC10H10F3NO2
Molecular Weight233.19 g/mol
Exact Mass233.07
IUPAC Name2-(2,3,4-trifluoro-N-methylanilino)propanoic acid
SMILESCC(C(=O)O)N(C)c1ccc(F)c(F)c1F
InChIInChI=1S/C10H10F3NO2/c1-5(10(15)16)14(2)7-4-3-6(11)8(12)9(7)13/h3-5H,1-2H3,(H,15,16)
InChIKeyXMAWWCQAZMERRF-UHFFFAOYSA-N
XLogP2.01
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.19
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid?
The IUPAC name of 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid (CID 67367878) is 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid.
What is the SMILES notation for 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid?
The canonical SMILES for 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid is CC(C(=O)O)N(C)c1ccc(F)c(F)c1F.
What is the InChIKey of 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid?
The InChIKey is XMAWWCQAZMERRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO2/c1-5(10(15)16)14(2)7-4-3-6(11)8(12)9(7)13/h3-5H,1-2H3,(H,15,16).
What are the key properties of 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid?
2-(2,3,4-trifluoro-N-methylanilino)propanoic acid has a molecular weight of 233.19 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,4-trifluoro-N-methylanilino)propanoic acid is sourced from PubChem (CID 67367878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).