C9H11ClN2O2 — CID 120964121
2-[(5-chloro-2-pyridinyl)-methylamino]propanoic acid (PubChem CID 120964121) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)-methylamino]propanoic acid.
| Compound Name | 2-[(5-chloro-2-pyridinyl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 120964121 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C9H11ClN2O2/c1-6(9(13)14)12(2)8-4-3-7(10)5-11-8/h3-6H,1-2H3,(H,13,14) |
| InChIKey | BSNRLYMZYKHPRS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |