C20H26N2S4 — CID 122230891
butyl-[7-[butyl(dithiocarboxy)amino]naphthalen-2-yl]carbamodithioic acid (PubChem CID 122230891) has the molecular formula C20H26N2S4 and a molecular weight of 422.71 g/mol. Its IUPAC name is butyl-[7-[butyl(dithiocarboxy)amino]naphthalen-2-yl]carbamodithioic acid.
| Compound Name | butyl-[7-[butyl(dithiocarboxy)amino]naphthalen-2-yl]carbamodithioic acid |
|---|---|
| PubChem CID | 122230891 |
| Molecular Formula | C20H26N2S4 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | butyl-[7-[butyl(dithiocarboxy)amino]naphthalen-2-yl]carbamodithioic acid |
| SMILES | CCCCN(C(=S)S)c1ccc2ccc(N(CCCC)C(=S)S)cc2c1 |
| InChI | InChI=1S/C20H26N2S4/c1-3-5-11-21(19(23)24)17-9-7-15-8-10-18(14-16(15)13-17)22(20(25)26)12-6-4-2/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | ATCXGLVTFFCKMD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|