About N-butyl-N-methylnaphthalen-2-amine;ethane;propanal
N-butyl-N-methylnaphthalen-2-amine;ethane;propanal (PubChem CID 142122324) has the molecular formula C22H37NO
and a molecular weight of 331.54 g/mol. Its IUPAC name is N-butyl-N-methylnaphthalen-2-amine;ethane;propanal.
Molecular Properties
| Compound Name | N-butyl-N-methylnaphthalen-2-amine;ethane;propanal |
| PubChem CID | 142122324 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | N-butyl-N-methylnaphthalen-2-amine;ethane;propanal |
| SMILES | CC.CC.CCC=O.CCCCN(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H19N.C3H6O.2C2H6/c1-3-4-11-16(2)15-10-9-13-7-5-6-8-14(13)12-15;1-2-3-4;2*1-2/h5-10,12H,3-4,11H2,1-2H3;3H,2H2,1H3;2*1-2H3 |
| InChIKey | HZJFJLPQKQCCOH-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-methylnaphthalen-2-amine;ethane;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-methylnaphthalen-2-amine;ethane;propanal?
The IUPAC name of N-butyl-N-methylnaphthalen-2-amine;ethane;propanal (CID 142122324) is N-butyl-N-methylnaphthalen-2-amine;ethane;propanal.
What is the SMILES notation for N-butyl-N-methylnaphthalen-2-amine;ethane;propanal?
The canonical SMILES for N-butyl-N-methylnaphthalen-2-amine;ethane;propanal is CC.CC.CCC=O.CCCCN(C)c1ccc2ccccc2c1.
What is the InChIKey of N-butyl-N-methylnaphthalen-2-amine;ethane;propanal?
The InChIKey is HZJFJLPQKQCCOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N.C3H6O.2C2H6/c1-3-4-11-16(2)15-10-9-13-7-5-6-8-14(13)12-15;1-2-3-4;2*1-2/h5-10,12H,3-4,11H2,1-2H3;3H,2H2,1H3;2*1-2H3.
What are the key properties of N-butyl-N-methylnaphthalen-2-amine;ethane;propanal?
N-butyl-N-methylnaphthalen-2-amine;ethane;propanal has a molecular weight of 331.54 g/mol, XLogP of 6.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-methylnaphthalen-2-amine;ethane;propanal is sourced from PubChem (CID 142122324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).