C15H20N2 — CID 115199230
1-N-methyl-1-N-naphthalen-2-ylbutane-1,3-diamine (PubChem CID 115199230) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-N-methyl-1-N-naphthalen-2-ylbutane-1,3-diamine.
| Compound Name | 1-N-methyl-1-N-naphthalen-2-ylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115199230 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-N-methyl-1-N-naphthalen-2-ylbutane-1,3-diamine |
| SMILES | CC(N)CCN(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H20N2/c1-12(16)9-10-17(2)15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11-12H,9-10,16H2,1-2H3 |
| InChIKey | QQGNXRZZTZCSFG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |