C12H19BrN2 — CID 115203761
1-N-(3-bromophenyl)-1-N-methylpentane-1,4-diamine (PubChem CID 115203761) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-N-(3-bromophenyl)-1-N-methylpentane-1,4-diamine.
| Compound Name | 1-N-(3-bromophenyl)-1-N-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 115203761 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-N-(3-bromophenyl)-1-N-methylpentane-1,4-diamine |
| SMILES | CC(N)CCCN(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H19BrN2/c1-10(14)5-4-8-15(2)12-7-3-6-11(13)9-12/h3,6-7,9-10H,4-5,8,14H2,1-2H3 |
| InChIKey | ZBSUQIHFCYABKU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |