C16H16Cl2N2O — CID 53440487
1-benzyl-1-(3,4-dichlorophenyl)-3,3-dimethylurea (PubChem CID 53440487) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-benzyl-1-(3,4-dichlorophenyl)-3,3-dimethylurea.
| Compound Name | 1-benzyl-1-(3,4-dichlorophenyl)-3,3-dimethylurea |
|---|---|
| PubChem CID | 53440487 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-benzyl-1-(3,4-dichlorophenyl)-3,3-dimethylurea |
| SMILES | CN(C)C(=O)N(Cc1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-19(2)16(21)20(11-12-6-4-3-5-7-12)13-8-9-14(17)15(18)10-13/h3-10H,11H2,1-2H3 |
| InChIKey | INCXTJWMAXTURA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |