C16H17ClN2O — CID 102087600
1-benzyl-3-(4-chlorophenyl)-1,3-dimethylurea (PubChem CID 102087600) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is 1-benzyl-3-(4-chlorophenyl)-1,3-dimethylurea.
| Compound Name | 1-benzyl-3-(4-chlorophenyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 102087600 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-benzyl-3-(4-chlorophenyl)-1,3-dimethylurea |
| SMILES | CN(Cc1ccccc1)C(=O)N(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O/c1-18(12-13-6-4-3-5-7-13)16(20)19(2)15-10-8-14(17)9-11-15/h3-11H,12H2,1-2H3 |
| InChIKey | KIPVEEHWACBXQZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |