C18H19ClN2O — CID 102415940
1-[(Z)-1-(4-chlorophenyl)prop-1-enyl]-1,3-dimethyl-3-phenylurea (PubChem CID 102415940) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 1-[(Z)-1-(4-chlorophenyl)prop-1-enyl]-1,3-dimethyl-3-phenylurea.
| Compound Name | 1-[(Z)-1-(4-chlorophenyl)prop-1-enyl]-1,3-dimethyl-3-phenylurea |
|---|---|
| PubChem CID | 102415940 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[(Z)-1-(4-chlorophenyl)prop-1-enyl]-1,3-dimethyl-3-phenylurea |
| SMILES | C/C=C(/c1ccc(Cl)cc1)N(C)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN2O/c1-4-17(14-10-12-15(19)13-11-14)21(3)18(22)20(2)16-8-6-5-7-9-16/h4-13H,1-3H3/b17-4- |
| InChIKey | ZQEQGUVGCXTKAJ-INGKJJEOSA-N |
| XLogP | 4.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |