C16H14Cl2N2O2 — CID 18432
N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)benzamide (PubChem CID 18432) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)benzamide.
| Compound Name | N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)benzamide |
|---|---|
| PubChem CID | 18432 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)benzamide |
| SMILES | CN(C)C(=O)N(C(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O2/c1-19(2)16(22)20(12-8-9-13(17)14(18)10-12)15(21)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | QQXXYTVEGCOZRF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |