C18H19Cl2NO — CID 888438
N-benzyl-N-tert-butyl-3,4-dichlorobenzamide (PubChem CID 888438) has the molecular formula C18H19Cl2NO and a molecular weight of 336.26 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-3,4-dichlorobenzamide.
| Compound Name | N-benzyl-N-tert-butyl-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 888438 |
| Molecular Formula | C18H19Cl2NO |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-benzyl-N-tert-butyl-3,4-dichlorobenzamide |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO/c1-18(2,3)21(12-13-7-5-4-6-8-13)17(22)14-9-10-15(19)16(20)11-14/h4-11H,12H2,1-3H3 |
| InChIKey | KIVPNHDHWZFGGN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |