C13H16Cl3NO — CID 15830435
N-benzyl-N-tert-butyl-2,2,2-trichloroacetamide (PubChem CID 15830435) has the molecular formula C13H16Cl3NO and a molecular weight of 308.64 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-2,2,2-trichloroacetamide.
| Compound Name | N-benzyl-N-tert-butyl-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 15830435 |
| Molecular Formula | C13H16Cl3NO |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | N-benzyl-N-tert-butyl-2,2,2-trichloroacetamide |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl3NO/c1-12(2,3)17(11(18)13(14,15)16)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | HNADDLPTMCJRKJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|