C14H14Cl3NO — CID 100995756
N-benzyl-2,2,2-trichloro-N-(cyclopenten-1-yl)acetamide (PubChem CID 100995756) has the molecular formula C14H14Cl3NO and a molecular weight of 318.63 g/mol. Its IUPAC name is N-benzyl-2,2,2-trichloro-N-(cyclopenten-1-yl)acetamide.
| Compound Name | N-benzyl-2,2,2-trichloro-N-(cyclopenten-1-yl)acetamide |
|---|---|
| PubChem CID | 100995756 |
| Molecular Formula | C14H14Cl3NO |
| Molecular Weight | 318.63 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | N-benzyl-2,2,2-trichloro-N-(cyclopenten-1-yl)acetamide |
| SMILES | O=C(N(Cc1ccccc1)C1=CCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3NO/c15-14(16,17)13(19)18(12-8-4-5-9-12)10-11-6-2-1-3-7-11/h1-3,6-8H,4-5,9-10H2 |
| InChIKey | WACBIKWBCMNJPW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|