C17H18Cl3NO3 — CID 15400110
[4-[benzyl-(2,2,2-trichloroacetyl)amino]cyclohexen-1-yl] acetate (PubChem CID 15400110) has the molecular formula C17H18Cl3NO3 and a molecular weight of 390.69 g/mol. Its IUPAC name is [4-[benzyl-(2,2,2-trichloroacetyl)amino]cyclohexen-1-yl] acetate.
| Compound Name | [4-[benzyl-(2,2,2-trichloroacetyl)amino]cyclohexen-1-yl] acetate |
|---|---|
| PubChem CID | 15400110 |
| Molecular Formula | C17H18Cl3NO3 |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | [4-[benzyl-(2,2,2-trichloroacetyl)amino]cyclohexen-1-yl] acetate |
| SMILES | CC(=O)OC1=CCC(N(Cc2ccccc2)C(=O)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C17H18Cl3NO3/c1-12(22)24-15-9-7-14(8-10-15)21(16(23)17(18,19)20)11-13-5-3-2-4-6-13/h2-6,9,14H,7-8,10-11H2,1H3 |
| InChIKey | HVQYSUWKXLNBBN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|