C27H29NO2 — CID 135079346
N-benzyl-N-(cyclohexen-1-yl)-3-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-ynamide (PubChem CID 135079346) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is N-benzyl-N-(cyclohexen-1-yl)-3-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-ynamide.
| Compound Name | N-benzyl-N-(cyclohexen-1-yl)-3-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-ynamide |
|---|---|
| PubChem CID | 135079346 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-benzyl-N-(cyclohexen-1-yl)-3-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)prop-2-ynamide |
| SMILES | COc1ccc2c(c1C#CC(=O)N(Cc1ccccc1)C1=CCCCC1)CCCC2 |
| InChI | InChI=1S/C27H29NO2/c1-30-26-18-16-22-12-8-9-15-24(22)25(26)17-19-27(29)28(23-13-6-3-7-14-23)20-21-10-4-2-5-11-21/h2,4-5,10-11,13,16,18H,3,6-9,12,14-15,20H2,1H3 |
| InChIKey | SIMICQNLSJZXAE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|