C18H19NO2 — CID 147285912
2-methoxy-N-phenyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide (PubChem CID 147285912) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-methoxy-N-phenyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide.
| Compound Name | 2-methoxy-N-phenyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 147285912 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-methoxy-N-phenyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| SMILES | COc1ccc2c(c1C(=O)Nc1ccccc1)CCCC2 |
| InChI | InChI=1S/C18H19NO2/c1-21-16-12-11-13-7-5-6-10-15(13)17(16)18(20)19-14-8-3-2-4-9-14/h2-4,8-9,11-12H,5-7,10H2,1H3,(H,19,20) |
| InChIKey | CTFNSXUKLABLHP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |