C16H16N2O4 — CID 4126051
N-(4-carbamoylphenyl)-2,6-dimethoxybenzamide (PubChem CID 4126051) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-2,6-dimethoxybenzamide.
| Compound Name | N-(4-carbamoylphenyl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 4126051 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(4-carbamoylphenyl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H16N2O4/c1-21-12-4-3-5-13(22-2)14(12)16(20)18-11-8-6-10(7-9-11)15(17)19/h3-9H,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | UXOYLYGNEKTCSM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |