C17H18N2O3 — CID 110764976
N-(4-carbamoylphenyl)-2-methoxy-4,6-dimethylbenzamide (PubChem CID 110764976) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-2-methoxy-4,6-dimethylbenzamide.
| Compound Name | N-(4-carbamoylphenyl)-2-methoxy-4,6-dimethylbenzamide |
|---|---|
| PubChem CID | 110764976 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-(4-carbamoylphenyl)-2-methoxy-4,6-dimethylbenzamide |
| SMILES | COc1cc(C)cc(C)c1C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-10-8-11(2)15(14(9-10)22-3)17(21)19-13-6-4-12(5-7-13)16(18)20/h4-9H,1-3H3,(H2,18,20)(H,19,21) |
| InChIKey | OXXUXGCWCIBVBE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |