C19H22N2O4 — CID 954631
N-[4-(butanoylamino)phenyl]-2,6-dimethoxybenzamide (PubChem CID 954631) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[4-(butanoylamino)phenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-(butanoylamino)phenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 954631 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[4-(butanoylamino)phenyl]-2,6-dimethoxybenzamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)c2c(OC)cccc2OC)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-6-17(22)20-13-9-11-14(12-10-13)21-19(23)18-15(24-2)7-5-8-16(18)25-3/h5,7-12H,4,6H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | AAHAVLUNCMWXKK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |