C17H20N2O3 — CID 43822918
N-[4-(1-aminoethyl)phenyl]-2,6-dimethoxybenzamide (PubChem CID 43822918) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)phenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-(1-aminoethyl)phenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 43822918 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[4-(1-aminoethyl)phenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(C(C)N)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-11(18)12-7-9-13(10-8-12)19-17(20)16-14(21-2)5-4-6-15(16)22-3/h4-11H,18H2,1-3H3,(H,19,20) |
| InChIKey | YZYBXXWGWFAVBM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |