C20H27N3O3 — CID 139887374
2,6-dimethoxy-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]benzamide (PubChem CID 139887374) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 139887374 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2,6-dimethoxy-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(NCCNC(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-14(2)21-12-13-22-15-8-10-16(11-9-15)23-20(24)19-17(25-3)6-5-7-18(19)26-4/h5-11,14,21-22H,12-13H2,1-4H3,(H,23,24) |
| InChIKey | CSJMNQIITXLDID-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|