C21H27N3O4 — CID 139887384
N-[4-[[2-(tert-butylamino)acetyl]amino]phenyl]-2,6-dimethoxybenzamide (PubChem CID 139887384) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[4-[[2-(tert-butylamino)acetyl]amino]phenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-[[2-(tert-butylamino)acetyl]amino]phenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 139887384 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[4-[[2-(tert-butylamino)acetyl]amino]phenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(NC(=O)CNC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-21(2,3)22-13-18(25)23-14-9-11-15(12-10-14)24-20(26)19-16(27-4)7-6-8-17(19)28-5/h6-12,22H,13H2,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | DANUCQCBMUYXMY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |