C12H15NO2 — CID 11521576
methyl 2-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate (PubChem CID 11521576) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is methyl 2-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate.
| Compound Name | methyl 2-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11521576 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | methyl 2-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)c1c(N)ccc2c1CCCC2 |
| InChI | InChI=1S/C12H15NO2/c1-15-12(14)11-9-5-3-2-4-8(9)6-7-10(11)13/h6-7H,2-5,13H2,1H3 |
| InChIKey | LDYCAHXKKKWYHW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|