C20H29NO2 — CID 57212324
benzyl 2-[cyclohexen-1-yl(methyl)amino]-4-methylpentanoate (PubChem CID 57212324) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is benzyl 2-[cyclohexen-1-yl(methyl)amino]-4-methylpentanoate.
| Compound Name | benzyl 2-[cyclohexen-1-yl(methyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 57212324 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | benzyl 2-[cyclohexen-1-yl(methyl)amino]-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCc1ccccc1)N(C)C1=CCCCC1 |
| InChI | InChI=1S/C20H29NO2/c1-16(2)14-19(21(3)18-12-8-5-9-13-18)20(22)23-15-17-10-6-4-7-11-17/h4,6-7,10-12,16,19H,5,8-9,13-15H2,1-3H3 |
| InChIKey | UEHNHHGMGKPZIX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |