C19H31ClN2O2 — CID 158388388
benzyl 4-methyl-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]pentanoate;hydrochloride (PubChem CID 158388388) has the molecular formula C19H31ClN2O2 and a molecular weight of 354.92 g/mol. Its IUPAC name is benzyl 4-methyl-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]pentanoate;hydrochloride.
| Compound Name | benzyl 4-methyl-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]pentanoate;hydrochloride |
|---|---|
| PubChem CID | 158388388 |
| Molecular Formula | C19H31ClN2O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | benzyl 4-methyl-2-[methyl-[[(2S)-pyrrolidin-2-yl]methyl]amino]pentanoate;hydrochloride |
| SMILES | CC(C)CC(C(=O)OCc1ccccc1)N(C)C[C@@H]1CCCN1.Cl |
| InChI | InChI=1S/C19H30N2O2.ClH/c1-15(2)12-18(21(3)13-17-10-7-11-20-17)19(22)23-14-16-8-5-4-6-9-16;/h4-6,8-9,15,17-18,20H,7,10-14H2,1-3H3;1H/t17-,18?;/m0./s1 |
| InChIKey | GVGVXFKCKXBOKS-OQICONIUSA-N |
| XLogP | 3.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |