C20H31NO2 — CID 59978108
benzyl 2-[cyclopentylmethyl(methyl)amino]-4-methylpentanoate (PubChem CID 59978108) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is benzyl 2-[cyclopentylmethyl(methyl)amino]-4-methylpentanoate.
| Compound Name | benzyl 2-[cyclopentylmethyl(methyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 59978108 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | benzyl 2-[cyclopentylmethyl(methyl)amino]-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCc1ccccc1)N(C)CC1CCCC1 |
| InChI | InChI=1S/C20H31NO2/c1-16(2)13-19(21(3)14-17-9-7-8-10-17)20(22)23-15-18-11-5-4-6-12-18/h4-6,11-12,16-17,19H,7-10,13-15H2,1-3H3 |
| InChIKey | FUYBXJAJCYIKRI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |