C15H19F3N2O2 — CID 97168559
benzyl N-[[(2R)-piperidin-2-yl]methyl]-N-(trifluoromethyl)carbamate (PubChem CID 97168559) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is benzyl N-[[(2R)-piperidin-2-yl]methyl]-N-(trifluoromethyl)carbamate.
| Compound Name | benzyl N-[[(2R)-piperidin-2-yl]methyl]-N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 97168559 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | benzyl N-[[(2R)-piperidin-2-yl]methyl]-N-(trifluoromethyl)carbamate |
| SMILES | O=C(OCc1ccccc1)N(C[C@H]1CCCCN1)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O2/c16-15(17,18)20(10-13-8-4-5-9-19-13)14(21)22-11-12-6-2-1-3-7-12/h1-3,6-7,13,19H,4-5,8-11H2/t13-/m1/s1 |
| InChIKey | FCGKOTIDFDUPTK-CYBMUJFWSA-N |
| XLogP | 3.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|