C17H22O — CID 142096371
3-(cyclohexen-1-yl)but-1-en-2-yloxymethylbenzene (PubChem CID 142096371) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)but-1-en-2-yloxymethylbenzene.
| Compound Name | 3-(cyclohexen-1-yl)but-1-en-2-yloxymethylbenzene |
|---|---|
| PubChem CID | 142096371 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 3-(cyclohexen-1-yl)but-1-en-2-yloxymethylbenzene |
| SMILES | C=C(OCc1ccccc1)C(C)C1=CCCCC1 |
| InChI | InChI=1S/C17H22O/c1-14(17-11-7-4-8-12-17)15(2)18-13-16-9-5-3-6-10-16/h3,5-6,9-11,14H,2,4,7-8,12-13H2,1H3 |
| InChIKey | FCKXNIXILNAICA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|