C29H33NO2 — CID 10993642
(1S,2S)-1-(cyclopenten-1-yl)-2-(dibenzylamino)-3-phenylmethoxypropan-1-ol (PubChem CID 10993642) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is (1S,2S)-1-(cyclopenten-1-yl)-2-(dibenzylamino)-3-phenylmethoxypropan-1-ol.
| Compound Name | (1S,2S)-1-(cyclopenten-1-yl)-2-(dibenzylamino)-3-phenylmethoxypropan-1-ol |
|---|---|
| PubChem CID | 10993642 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (1S,2S)-1-(cyclopenten-1-yl)-2-(dibenzylamino)-3-phenylmethoxypropan-1-ol |
| SMILES | O[C@@H](C1=CCCC1)[C@H](COCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H33NO2/c31-29(27-18-10-11-19-27)28(23-32-22-26-16-8-3-9-17-26)30(20-24-12-4-1-5-13-24)21-25-14-6-2-7-15-25/h1-9,12-18,28-29,31H,10-11,19-23H2/t28-,29-/m0/s1 |
| InChIKey | KQIHZPXYMIVVRC-VMPREFPWSA-N |
| XLogP | 5.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|