C35H55NOSn — CID 10746492
(1S,2S)-N,N-dibenzyl-1-(cyclopenten-1-yl)-1-(tributylstannylmethoxy)propan-2-amine (PubChem CID 10746492) has the molecular formula C35H55NOSn and a molecular weight of 624.54 g/mol. Its IUPAC name is (1S,2S)-N,N-dibenzyl-1-(cyclopenten-1-yl)-1-(tributylstannylmethoxy)propan-2-amine.
| Compound Name | (1S,2S)-N,N-dibenzyl-1-(cyclopenten-1-yl)-1-(tributylstannylmethoxy)propan-2-amine |
|---|---|
| PubChem CID | 10746492 |
| Molecular Formula | C35H55NOSn |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | (1S,2S)-N,N-dibenzyl-1-(cyclopenten-1-yl)-1-(tributylstannylmethoxy)propan-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@@H](C1=CCCC1)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H28NO.3C4H9.Sn/c1-19(23(25-2)22-15-9-10-16-22)24(17-20-11-5-3-6-12-20)18-21-13-7-4-8-14-21;3*1-3-4-2;/h3-8,11-15,19,23H,2,9-10,16-18H2,1H3;3*1,3-4H2,2H3;/t19-,23+;;;;/m0..../s1 |
| InChIKey | LHMWRTKCTODFSW-GRZPZBPMSA-N |
| XLogP | 9.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|