C34H55NOSn — CID 14660998
(E)-N,N-dibenzyl-2-methyl-6-(tributylstannylmethoxy)hex-4-en-3-amine (PubChem CID 14660998) has the molecular formula C34H55NOSn and a molecular weight of 612.53 g/mol. Its IUPAC name is (E)-N,N-dibenzyl-2-methyl-6-(tributylstannylmethoxy)hex-4-en-3-amine.
| Compound Name | (E)-N,N-dibenzyl-2-methyl-6-(tributylstannylmethoxy)hex-4-en-3-amine |
|---|---|
| PubChem CID | 14660998 |
| Molecular Formula | C34H55NOSn |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 613.33 |
| IUPAC Name | (E)-N,N-dibenzyl-2-methyl-6-(tributylstannylmethoxy)hex-4-en-3-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)COC/C=C/C(C(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H28NO.3C4H9.Sn/c1-19(2)22(15-10-16-24-3)23(17-20-11-6-4-7-12-20)18-21-13-8-5-9-14-21;3*1-3-4-2;/h4-15,19,22H,3,16-18H2,1-2H3;3*1,3-4H2,2H3;/b15-10+;;;; |
| InChIKey | UORGMVNUHJEDBZ-VYYKFXENSA-N |
| XLogP | 9.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|