C25H27NO2 — CID 101382719
(2S,3R)-2-(dibenzylamino)-3-phenylmethoxybutanal (PubChem CID 101382719) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (2S,3R)-2-(dibenzylamino)-3-phenylmethoxybutanal.
| Compound Name | (2S,3R)-2-(dibenzylamino)-3-phenylmethoxybutanal |
|---|---|
| PubChem CID | 101382719 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (2S,3R)-2-(dibenzylamino)-3-phenylmethoxybutanal |
| SMILES | C[C@@H](OCc1ccccc1)[C@@H](C=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H27NO2/c1-21(28-20-24-15-9-4-10-16-24)25(19-27)26(17-22-11-5-2-6-12-22)18-23-13-7-3-8-14-23/h2-16,19,21,25H,17-18,20H2,1H3/t21-,25-/m1/s1 |
| InChIKey | FNRNIOXKQARQAP-PXDATVDWSA-N |
| XLogP | 4.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|