C13H21NO — CID 22369442
N,N-diethyl-1-phenylmethoxyethanamine (PubChem CID 22369442) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N,N-diethyl-1-phenylmethoxyethanamine.
| Compound Name | N,N-diethyl-1-phenylmethoxyethanamine |
|---|---|
| PubChem CID | 22369442 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N,N-diethyl-1-phenylmethoxyethanamine |
| SMILES | CCN(CC)C(C)OCc1ccccc1 |
| InChI | InChI=1S/C13H21NO/c1-4-14(5-2)12(3)15-11-13-9-7-6-8-10-13/h6-10,12H,4-5,11H2,1-3H3 |
| InChIKey | JECSCLDELMOBLR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|