C24H29NO2 — CID 101463161
ethyl 3-(cyclopenten-1-yl)-2-(dibenzylamino)propanoate (PubChem CID 101463161) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is ethyl 3-(cyclopenten-1-yl)-2-(dibenzylamino)propanoate.
| Compound Name | ethyl 3-(cyclopenten-1-yl)-2-(dibenzylamino)propanoate |
|---|---|
| PubChem CID | 101463161 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | ethyl 3-(cyclopenten-1-yl)-2-(dibenzylamino)propanoate |
| SMILES | CCOC(=O)C(CC1=CCCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-2-27-24(26)23(17-20-11-9-10-12-20)25(18-21-13-5-3-6-14-21)19-22-15-7-4-8-16-22/h3-8,11,13-16,23H,2,9-10,12,17-19H2,1H3 |
| InChIKey | DTWDXIXULCFVTO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|