C23H26N2O5 — CID 102477685
ethyl 2-(dibenzylamino)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate (PubChem CID 102477685) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl 2-(dibenzylamino)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate.
| Compound Name | ethyl 2-(dibenzylamino)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate |
|---|---|
| PubChem CID | 102477685 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | ethyl 2-(dibenzylamino)-4-oxo-4-(2-oxo-1,3-oxazolidin-3-yl)butanoate |
| SMILES | CCOC(=O)C(CC(=O)N1CCOC1=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H26N2O5/c1-2-29-22(27)20(15-21(26)25-13-14-30-23(25)28)24(16-18-9-5-3-6-10-18)17-19-11-7-4-8-12-19/h3-12,20H,2,13-17H2,1H3 |
| InChIKey | OIUQVCKYOUSKPV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |